C48H44Br4N2OS2 — CID 160945597
2-amino-5-bromobenzenethiol;6-bromo-2-(7-bromo-9,9-diethylfluoren-2-yl)-1,3-benzothiazole;2-bromo-9,9-diethyl-7-methoxyfluorene (PubChem CID 160945597) has the molecular formula C48H44Br4N2OS2 and a molecular weight of 1048.64 g/mol. Its IUPAC name is 2-amino-5-bromobenzenethiol;6-bromo-2-(7-bromo-9,9-diethylfluoren-2-yl)-1,3-benzothiazole;2-bromo-9,9-diethyl-7-methoxyfluorene.
| Compound Name | 2-amino-5-bromobenzenethiol;6-bromo-2-(7-bromo-9,9-diethylfluoren-2-yl)-1,3-benzothiazole;2-bromo-9,9-diethyl-7-methoxyfluorene |
|---|---|
| PubChem CID | 160945597 |
| Molecular Formula | C48H44Br4N2OS2 |
| Molecular Weight | 1048.64 g/mol |
| Exact Mass | 1043.96 |
| IUPAC Name | 2-amino-5-bromobenzenethiol;6-bromo-2-(7-bromo-9,9-diethylfluoren-2-yl)-1,3-benzothiazole;2-bromo-9,9-diethyl-7-methoxyfluorene |
| SMILES | CCC1(CC)c2cc(Br)ccc2-c2ccc(-c3nc4ccc(Br)cc4s3)cc21.CCC1(CC)c2cc(Br)ccc2-c2ccc(OC)cc21.Nc1ccc(Br)cc1S |
| InChI | InChI=1S/C24H19Br2NS.C18H19BrO.C6H6BrNS/c1-3-24(4-2)19-11-14(23-27-21-10-7-16(26)13-22(21)28-23)5-8-17(19)18-9-6-15(25)12-20(18)24;1-4-18(5-2)16-10-12(19)6-8-14(16)15-9-7-13(20-3)11-17(15)18;7-4-1-2-5(8)6(9)3-4/h5-13H,3-4H2,1-2H3;6-11H,4-5H2,1-3H3;1-3,9H,8H2 |
| InChIKey | SVBHRBNCNWEGDO-UHFFFAOYSA-N |
| XLogP | 16.44 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1048.64 |
| LogP ≤ 5 | 16.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|