C16H17BrN2S — CID 142943002
4-(6-bromo-1,3-benzothiazol-2-yl)-2-methylaniline;ethane (PubChem CID 142943002) has the molecular formula C16H17BrN2S and a molecular weight of 349.30 g/mol. Its IUPAC name is 4-(6-bromo-1,3-benzothiazol-2-yl)-2-methylaniline;ethane.
| Compound Name | 4-(6-bromo-1,3-benzothiazol-2-yl)-2-methylaniline;ethane |
|---|---|
| PubChem CID | 142943002 |
| Molecular Formula | C16H17BrN2S |
| Molecular Weight | 349.30 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | 4-(6-bromo-1,3-benzothiazol-2-yl)-2-methylaniline;ethane |
| SMILES | CC.Cc1cc(-c2nc3ccc(Br)cc3s2)ccc1N |
| InChI | InChI=1S/C14H11BrN2S.C2H6/c1-8-6-9(2-4-11(8)16)14-17-12-5-3-10(15)7-13(12)18-14;1-2/h2-7H,16H2,1H3;1-2H3 |
| InChIKey | WUWPFCWGQWDJOS-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.30 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|