C20H28N2O2S — CID 142942990
ethane;4-[6-(methoxymethoxy)-1,3-benzothiazol-2-yl]-2-methylaniline (PubChem CID 142942990) has the molecular formula C20H28N2O2S and a molecular weight of 360.52 g/mol. Its IUPAC name is ethane;4-[6-(methoxymethoxy)-1,3-benzothiazol-2-yl]-2-methylaniline.
| Compound Name | ethane;4-[6-(methoxymethoxy)-1,3-benzothiazol-2-yl]-2-methylaniline |
|---|---|
| PubChem CID | 142942990 |
| Molecular Formula | C20H28N2O2S |
| Molecular Weight | 360.52 g/mol |
| Exact Mass | 360.19 |
| IUPAC Name | ethane;4-[6-(methoxymethoxy)-1,3-benzothiazol-2-yl]-2-methylaniline |
| SMILES | CC.CC.COCOc1ccc2nc(-c3ccc(N)c(C)c3)sc2c1 |
| InChI | InChI=1S/C16H16N2O2S.2C2H6/c1-10-7-11(3-5-13(10)17)16-18-14-6-4-12(20-9-19-2)8-15(14)21-16;2*1-2/h3-8H,9,17H2,1-2H3;2*1-2H3 |
| InChIKey | OJTBMDBHCGYBLU-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.52 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|