C28H23IN4O2S2 — CID 160555222
2-iodo-4-(6-methoxy-1,3-benzothiazol-2-yl)aniline;4-(6-methoxy-1,3-benzothiazol-2-yl)aniline (PubChem CID 160555222) has the molecular formula C28H23IN4O2S2 and a molecular weight of 638.56 g/mol. Its IUPAC name is 2-iodo-4-(6-methoxy-1,3-benzothiazol-2-yl)aniline;4-(6-methoxy-1,3-benzothiazol-2-yl)aniline.
| Compound Name | 2-iodo-4-(6-methoxy-1,3-benzothiazol-2-yl)aniline;4-(6-methoxy-1,3-benzothiazol-2-yl)aniline |
|---|---|
| PubChem CID | 160555222 |
| Molecular Formula | C28H23IN4O2S2 |
| Molecular Weight | 638.56 g/mol |
| Exact Mass | 638.03 |
| IUPAC Name | 2-iodo-4-(6-methoxy-1,3-benzothiazol-2-yl)aniline;4-(6-methoxy-1,3-benzothiazol-2-yl)aniline |
| SMILES | COc1ccc2nc(-c3ccc(N)c(I)c3)sc2c1.COc1ccc2nc(-c3ccc(N)cc3)sc2c1 |
| InChI | InChI=1S/C14H11IN2OS.C14H12N2OS/c1-18-9-3-5-12-13(7-9)19-14(17-12)8-2-4-11(16)10(15)6-8;1-17-11-6-7-12-13(8-11)18-14(16-12)9-2-4-10(15)5-3-9/h2-7H,16H2,1H3;2-8H,15H2,1H3 |
| InChIKey | QYPCEDOFHDXBLM-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 96.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.56 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|