C15H12N2O2S — CID 58960450
[2-(4-aminophenyl)-1,3-benzothiazol-6-yl] acetate (PubChem CID 58960450) has the molecular formula C15H12N2O2S and a molecular weight of 284.34 g/mol. Its IUPAC name is [2-(4-aminophenyl)-1,3-benzothiazol-6-yl] acetate.
| Compound Name | [2-(4-aminophenyl)-1,3-benzothiazol-6-yl] acetate |
|---|---|
| PubChem CID | 58960450 |
| Molecular Formula | C15H12N2O2S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.06 |
| IUPAC Name | [2-(4-aminophenyl)-1,3-benzothiazol-6-yl] acetate |
| SMILES | CC(=O)Oc1ccc2nc(-c3ccc(N)cc3)sc2c1 |
| InChI | InChI=1S/C15H12N2O2S/c1-9(18)19-12-6-7-13-14(8-12)20-15(17-13)10-2-4-11(16)5-3-10/h2-8H,16H2,1H3 |
| InChIKey | YWLHPJHQBQLULW-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|