C13H11BN2O2S — CID 140929260
[2-(4-aminophenyl)-1,3-benzothiazol-6-yl]boronic acid (PubChem CID 140929260) has the molecular formula C13H11BN2O2S and a molecular weight of 270.12 g/mol. Its IUPAC name is [2-(4-aminophenyl)-1,3-benzothiazol-6-yl]boronic acid.
| Compound Name | [2-(4-aminophenyl)-1,3-benzothiazol-6-yl]boronic acid |
|---|---|
| PubChem CID | 140929260 |
| Molecular Formula | C13H11BN2O2S |
| Molecular Weight | 270.12 g/mol |
| Exact Mass | 270.06 |
| IUPAC Name | [2-(4-aminophenyl)-1,3-benzothiazol-6-yl]boronic acid |
| SMILES | Nc1ccc(-c2nc3ccc(B(O)O)cc3s2)cc1 |
| InChI | InChI=1S/C13H11BN2O2S/c15-10-4-1-8(2-5-10)13-16-11-6-3-9(14(17)18)7-12(11)19-13/h1-7,17-18H,15H2 |
| InChIKey | YOWFNZOWISPCAC-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.12 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|