(2-amino-1,3-benzothiazol-6-yl)boronic acid

C7H7BN2O2S — CID 119086634

IUPAC(2-amino-1,3-benzothiazol-6-yl)boronic acid
SMILESNc1nc2ccc(B(O)O)cc2s1
InChIInChI=1S/C7H7BN2O2S/c9-7-10-5-2-1-4(8(11)12)3-6(5)13-7/h1-3,11-12H,(H2,9,10)
InChIKeyVRUIFEZMUYLQGH-UHFFFAOYSA-N
MW194.02 g/mol
LogP-0.44
Rot. Bonds1

About (2-amino-1,3-benzothiazol-6-yl)boronic acid

(2-amino-1,3-benzothiazol-6-yl)boronic acid (PubChem CID 119086634) has the molecular formula C7H7BN2O2S and a molecular weight of 194.02 g/mol. Its IUPAC name is (2-amino-1,3-benzothiazol-6-yl)boronic acid.

Molecular Properties

Compound Name(2-amino-1,3-benzothiazol-6-yl)boronic acid
PubChem CID119086634
Molecular FormulaC7H7BN2O2S
Molecular Weight194.02 g/mol
Exact Mass194.03
IUPAC Name(2-amino-1,3-benzothiazol-6-yl)boronic acid
SMILESNc1nc2ccc(B(O)O)cc2s1
InChIInChI=1S/C7H7BN2O2S/c9-7-10-5-2-1-4(8(11)12)3-6(5)13-7/h1-3,11-12H,(H2,9,10)
InChIKeyVRUIFEZMUYLQGH-UHFFFAOYSA-N
XLogP-0.44
TPSA79.37 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500194.02
LogP ≤ 5-0.44
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (2-amino-1,3-benzothiazol-6-yl)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2-amino-1,3-benzothiazol-6-yl)boronic acid?
The IUPAC name of (2-amino-1,3-benzothiazol-6-yl)boronic acid (CID 119086634) is (2-amino-1,3-benzothiazol-6-yl)boronic acid.
What is the SMILES notation for (2-amino-1,3-benzothiazol-6-yl)boronic acid?
The canonical SMILES for (2-amino-1,3-benzothiazol-6-yl)boronic acid is Nc1nc2ccc(B(O)O)cc2s1.
What is the InChIKey of (2-amino-1,3-benzothiazol-6-yl)boronic acid?
The InChIKey is VRUIFEZMUYLQGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BN2O2S/c9-7-10-5-2-1-4(8(11)12)3-6(5)13-7/h1-3,11-12H,(H2,9,10).
What are the key properties of (2-amino-1,3-benzothiazol-6-yl)boronic acid?
(2-amino-1,3-benzothiazol-6-yl)boronic acid has a molecular weight of 194.02 g/mol, XLogP of -0.44, 1 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-amino-1,3-benzothiazol-6-yl)boronic acid is sourced from PubChem (CID 119086634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).