C7H7BN2O2S — CID 119086634
(2-amino-1,3-benzothiazol-6-yl)boronic acid (PubChem CID 119086634) has the molecular formula C7H7BN2O2S and a molecular weight of 194.02 g/mol. Its IUPAC name is (2-amino-1,3-benzothiazol-6-yl)boronic acid.
| Compound Name | (2-amino-1,3-benzothiazol-6-yl)boronic acid |
|---|---|
| PubChem CID | 119086634 |
| Molecular Formula | C7H7BN2O2S |
| Molecular Weight | 194.02 g/mol |
| Exact Mass | 194.03 |
| IUPAC Name | (2-amino-1,3-benzothiazol-6-yl)boronic acid |
| SMILES | Nc1nc2ccc(B(O)O)cc2s1 |
| InChI | InChI=1S/C7H7BN2O2S/c9-7-10-5-2-1-4(8(11)12)3-6(5)13-7/h1-3,11-12H,(H2,9,10) |
| InChIKey | VRUIFEZMUYLQGH-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.02 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|