C7H8N4S — CID 116994182
6-hydrazinyl-1,3-benzothiazol-2-amine (PubChem CID 116994182) has the molecular formula C7H8N4S and a molecular weight of 180.24 g/mol. Its IUPAC name is 6-hydrazinyl-1,3-benzothiazol-2-amine.
| Compound Name | 6-hydrazinyl-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 116994182 |
| Molecular Formula | C7H8N4S |
| Molecular Weight | 180.24 g/mol |
| Exact Mass | 180.05 |
| IUPAC Name | 6-hydrazinyl-1,3-benzothiazol-2-amine |
| SMILES | NNc1ccc2nc(N)sc2c1 |
| InChI | InChI=1S/C7H8N4S/c8-7-10-5-2-1-4(11-9)3-6(5)12-7/h1-3,11H,9H2,(H2,8,10) |
| InChIKey | KZUIBRAWZMDNMT-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 76.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|