C9H11N3S — CID 17244961
6-N,6-N-dimethyl-1,3-benzothiazole-2,6-diamine (PubChem CID 17244961) has the molecular formula C9H11N3S and a molecular weight of 193.27 g/mol. Its IUPAC name is 6-N,6-N-dimethyl-1,3-benzothiazole-2,6-diamine.
| Compound Name | 6-N,6-N-dimethyl-1,3-benzothiazole-2,6-diamine |
|---|---|
| PubChem CID | 17244961 |
| Molecular Formula | C9H11N3S |
| Molecular Weight | 193.27 g/mol |
| Exact Mass | 193.07 |
| IUPAC Name | 6-N,6-N-dimethyl-1,3-benzothiazole-2,6-diamine |
| SMILES | CN(C)c1ccc2nc(N)sc2c1 |
| InChI | InChI=1S/C9H11N3S/c1-12(2)6-3-4-7-8(5-6)13-9(10)11-7/h3-5H,1-2H3,(H2,10,11) |
| InChIKey | DCUFLOLNQPJBDW-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |