C7H5FN2O2S2 — CID 130156167
2-amino-1,3-benzothiazole-6-sulfonyl fluoride (PubChem CID 130156167) has the molecular formula C7H5FN2O2S2 and a molecular weight of 232.26 g/mol. Its IUPAC name is 2-amino-1,3-benzothiazole-6-sulfonyl fluoride.
| Compound Name | 2-amino-1,3-benzothiazole-6-sulfonyl fluoride |
|---|---|
| PubChem CID | 130156167 |
| Molecular Formula | C7H5FN2O2S2 |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 231.98 |
| IUPAC Name | 2-amino-1,3-benzothiazole-6-sulfonyl fluoride |
| SMILES | Nc1nc2ccc(S(=O)(=O)F)cc2s1 |
| InChI | InChI=1S/C7H5FN2O2S2/c8-14(11,12)4-1-2-5-6(3-4)13-7(9)10-5/h1-3H,(H2,9,10) |
| InChIKey | MZYRTMMXMPIVQJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |