C7H5FN2O3S2 — CID 118566745
2-amino-6-fluorosulfonyloxy-1,3-benzothiazole (PubChem CID 118566745) has the molecular formula C7H5FN2O3S2 and a molecular weight of 248.26 g/mol. Its IUPAC name is 2-amino-6-fluorosulfonyloxy-1,3-benzothiazole.
| Compound Name | 2-amino-6-fluorosulfonyloxy-1,3-benzothiazole |
|---|---|
| PubChem CID | 118566745 |
| Molecular Formula | C7H5FN2O3S2 |
| Molecular Weight | 248.26 g/mol |
| Exact Mass | 247.97 |
| IUPAC Name | 2-amino-6-fluorosulfonyloxy-1,3-benzothiazole |
| SMILES | Nc1nc2ccc(OS(=O)(=O)F)cc2s1 |
| InChI | InChI=1S/C7H5FN2O3S2/c8-15(11,12)13-4-1-2-5-6(3-4)14-7(9)10-5/h1-3H,(H2,9,10) |
| InChIKey | BMDOCXWAKMTZFO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.26 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |