C9H9FN2OS — CID 59282924
6-(2-fluoroethoxy)-1,3-benzothiazol-2-amine (PubChem CID 59282924) has the molecular formula C9H9FN2OS and a molecular weight of 212.25 g/mol. Its IUPAC name is 6-(2-fluoroethoxy)-1,3-benzothiazol-2-amine.
| Compound Name | 6-(2-fluoroethoxy)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 59282924 |
| Molecular Formula | C9H9FN2OS |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 6-(2-fluoroethoxy)-1,3-benzothiazol-2-amine |
| SMILES | Nc1nc2ccc(OCCF)cc2s1 |
| InChI | InChI=1S/C9H9FN2OS/c10-3-4-13-6-1-2-7-8(5-6)14-9(11)12-7/h1-2,5H,3-4H2,(H2,11,12) |
| InChIKey | KUGLYZLBXUVXIW-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |