C16H15N3O2S2 — CID 159412821
6-methoxy-1,3-benzothiazol-2-amine;6-methoxy-1,3-benzothiazole (PubChem CID 159412821) has the molecular formula C16H15N3O2S2 and a molecular weight of 345.45 g/mol. Its IUPAC name is 6-methoxy-1,3-benzothiazol-2-amine;6-methoxy-1,3-benzothiazole.
| Compound Name | 6-methoxy-1,3-benzothiazol-2-amine;6-methoxy-1,3-benzothiazole |
|---|---|
| PubChem CID | 159412821 |
| Molecular Formula | C16H15N3O2S2 |
| Molecular Weight | 345.45 g/mol |
| Exact Mass | 345.06 |
| IUPAC Name | 6-methoxy-1,3-benzothiazol-2-amine;6-methoxy-1,3-benzothiazole |
| SMILES | COc1ccc2nc(N)sc2c1.COc1ccc2ncsc2c1 |
| InChI | InChI=1S/C8H8N2OS.C8H7NOS/c1-11-5-2-3-6-7(4-5)12-8(9)10-6;1-10-6-2-3-7-8(4-6)11-5-9-7/h2-4H,1H3,(H2,9,10);2-5H,1H3 |
| InChIKey | LOUGDHRWCABQDF-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 70.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |