C15H14N2OS — CID 79510887
(6-methoxy-1,3-benzothiazol-2-yl)-phenylmethanamine (PubChem CID 79510887) has the molecular formula C15H14N2OS and a molecular weight of 270.36 g/mol. Its IUPAC name is (6-methoxy-1,3-benzothiazol-2-yl)-phenylmethanamine.
| Compound Name | (6-methoxy-1,3-benzothiazol-2-yl)-phenylmethanamine |
|---|---|
| PubChem CID | 79510887 |
| Molecular Formula | C15H14N2OS |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.08 |
| IUPAC Name | (6-methoxy-1,3-benzothiazol-2-yl)-phenylmethanamine |
| SMILES | COc1ccc2nc(C(N)c3ccccc3)sc2c1 |
| InChI | InChI=1S/C15H14N2OS/c1-18-11-7-8-12-13(9-11)19-15(17-12)14(16)10-5-3-2-4-6-10/h2-9,14H,16H2,1H3 |
| InChIKey | QTBJXAKFPINONI-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |