C14H17NO5S — CID 171898169
ethyl 3,4-dihydroxy-4-(6-methoxy-1,3-benzothiazol-2-yl)butanoate (PubChem CID 171898169) has the molecular formula C14H17NO5S and a molecular weight of 311.36 g/mol. Its IUPAC name is ethyl 3,4-dihydroxy-4-(6-methoxy-1,3-benzothiazol-2-yl)butanoate.
| Compound Name | ethyl 3,4-dihydroxy-4-(6-methoxy-1,3-benzothiazol-2-yl)butanoate |
|---|---|
| PubChem CID | 171898169 |
| Molecular Formula | C14H17NO5S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.08 |
| IUPAC Name | ethyl 3,4-dihydroxy-4-(6-methoxy-1,3-benzothiazol-2-yl)butanoate |
| SMILES | CCOC(=O)CC(O)C(O)c1nc2ccc(OC)cc2s1 |
| InChI | InChI=1S/C14H17NO5S/c1-3-20-12(17)7-10(16)13(18)14-15-9-5-4-8(19-2)6-11(9)21-14/h4-6,10,13,16,18H,3,7H2,1-2H3 |
| InChIKey | IFQRCBASUBTZQS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 88.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |