About 1-(6-methoxy-1,3-benzothiazol-2-yl)ethane-1,2-diamine
1-(6-methoxy-1,3-benzothiazol-2-yl)ethane-1,2-diamine (PubChem CID 18449216) has the molecular formula C10H13N3OS
and a molecular weight of 223.30 g/mol. Its IUPAC name is 1-(6-methoxy-1,3-benzothiazol-2-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | 1-(6-methoxy-1,3-benzothiazol-2-yl)ethane-1,2-diamine |
| PubChem CID | 18449216 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 1-(6-methoxy-1,3-benzothiazol-2-yl)ethane-1,2-diamine |
| SMILES | COc1ccc2nc(C(N)CN)sc2c1 |
| InChI | InChI=1S/C10H13N3OS/c1-14-6-2-3-8-9(4-6)15-10(13-8)7(12)5-11/h2-4,7H,5,11-12H2,1H3 |
| InChIKey | RDBBZBVWBJEDNV-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(6-methoxy-1,3-benzothiazol-2-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-methoxy-1,3-benzothiazol-2-yl)ethane-1,2-diamine?
The IUPAC name of 1-(6-methoxy-1,3-benzothiazol-2-yl)ethane-1,2-diamine (CID 18449216) is 1-(6-methoxy-1,3-benzothiazol-2-yl)ethane-1,2-diamine.
What is the SMILES notation for 1-(6-methoxy-1,3-benzothiazol-2-yl)ethane-1,2-diamine?
The canonical SMILES for 1-(6-methoxy-1,3-benzothiazol-2-yl)ethane-1,2-diamine is COc1ccc2nc(C(N)CN)sc2c1.
What is the InChIKey of 1-(6-methoxy-1,3-benzothiazol-2-yl)ethane-1,2-diamine?
The InChIKey is RDBBZBVWBJEDNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3OS/c1-14-6-2-3-8-9(4-6)15-10(13-8)7(12)5-11/h2-4,7H,5,11-12H2,1H3.
What are the key properties of 1-(6-methoxy-1,3-benzothiazol-2-yl)ethane-1,2-diamine?
1-(6-methoxy-1,3-benzothiazol-2-yl)ethane-1,2-diamine has a molecular weight of 223.30 g/mol, XLogP of 1.26, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-methoxy-1,3-benzothiazol-2-yl)ethane-1,2-diamine is sourced from PubChem (CID 18449216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).