C10H13N3OS — CID 18449216
1-(6-methoxy-1,3-benzothiazol-2-yl)ethane-1,2-diamine (PubChem CID 18449216) has the molecular formula C10H13N3OS and a molecular weight of 223.30 g/mol. Its IUPAC name is 1-(6-methoxy-1,3-benzothiazol-2-yl)ethane-1,2-diamine.
| Compound Name | 1-(6-methoxy-1,3-benzothiazol-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 18449216 |
| Molecular Formula | C10H13N3OS |
| Molecular Weight | 223.30 g/mol |
| Exact Mass | 223.08 |
| IUPAC Name | 1-(6-methoxy-1,3-benzothiazol-2-yl)ethane-1,2-diamine |
| SMILES | COc1ccc2nc(C(N)CN)sc2c1 |
| InChI | InChI=1S/C10H13N3OS/c1-14-6-2-3-8-9(4-6)15-10(13-8)7(12)5-11/h2-4,7H,5,11-12H2,1H3 |
| InChIKey | RDBBZBVWBJEDNV-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |