C8H8N2NaOS — CID 158604119
CID 158604119 (PubChem CID 158604119) has the molecular formula C8H8N2NaOS and a molecular weight of 203.22 g/mol.
| Compound Name | CID 158604119 |
|---|---|
| PubChem CID | 158604119 |
| Molecular Formula | C8H8N2NaOS |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.03 |
| IUPAC Name | — |
| SMILES | COc1ccc2nc(N)sc2c1.[Na] |
| InChI | InChI=1S/C8H8N2OS.Na/c1-11-5-2-3-6-7(4-5)12-8(9)10-6;/h2-4H,1H3,(H2,9,10); |
| InChIKey | HVZSBSKNCIPCAI-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |