C19H16N2O3S — CID 130443924
6-(6,7-dimethoxynaphthalen-1-yl)oxy-1,3-benzothiazol-2-amine (PubChem CID 130443924) has the molecular formula C19H16N2O3S and a molecular weight of 352.42 g/mol. Its IUPAC name is 6-(6,7-dimethoxynaphthalen-1-yl)oxy-1,3-benzothiazol-2-amine.
| Compound Name | 6-(6,7-dimethoxynaphthalen-1-yl)oxy-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 130443924 |
| Molecular Formula | C19H16N2O3S |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | 6-(6,7-dimethoxynaphthalen-1-yl)oxy-1,3-benzothiazol-2-amine |
| SMILES | COc1cc2cccc(Oc3ccc4nc(N)sc4c3)c2cc1OC |
| InChI | InChI=1S/C19H16N2O3S/c1-22-16-8-11-4-3-5-15(13(11)10-17(16)23-2)24-12-6-7-14-18(9-12)25-19(20)21-14/h3-10H,1-2H3,(H2,20,21) |
| InChIKey | BUKLZSWDXIUFHE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 66.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |