C9H8F2N2OS — CID 89211366
6-(1,1-difluoroethoxy)-1,3-benzothiazol-2-amine (PubChem CID 89211366) has the molecular formula C9H8F2N2OS and a molecular weight of 230.24 g/mol. Its IUPAC name is 6-(1,1-difluoroethoxy)-1,3-benzothiazol-2-amine.
| Compound Name | 6-(1,1-difluoroethoxy)-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 89211366 |
| Molecular Formula | C9H8F2N2OS |
| Molecular Weight | 230.24 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 6-(1,1-difluoroethoxy)-1,3-benzothiazol-2-amine |
| SMILES | CC(F)(F)Oc1ccc2nc(N)sc2c1 |
| InChI | InChI=1S/C9H8F2N2OS/c1-9(10,11)14-5-2-3-6-7(4-5)15-8(12)13-6/h2-4H,1H3,(H2,12,13) |
| InChIKey | KTFPYAZIFRXTNQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.24 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |