C9H7F3N2OS — CID 162561361
[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]methanamine (PubChem CID 162561361) has the molecular formula C9H7F3N2OS and a molecular weight of 248.23 g/mol. Its IUPAC name is [6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]methanamine.
| Compound Name | [6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]methanamine |
|---|---|
| PubChem CID | 162561361 |
| Molecular Formula | C9H7F3N2OS |
| Molecular Weight | 248.23 g/mol |
| Exact Mass | 248.02 |
| IUPAC Name | [6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]methanamine |
| SMILES | NCc1nc2ccc(OC(F)(F)F)cc2s1 |
| InChI | InChI=1S/C9H7F3N2OS/c10-9(11,12)15-5-1-2-6-7(3-5)16-8(4-13)14-6/h1-3H,4,13H2 |
| InChIKey | QFOMHPDUFNIWLX-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.23 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |