C15H10F3NOS — CID 156595781
2-benzyl-6-(trifluoromethoxy)-1,3-benzothiazole (PubChem CID 156595781) has the molecular formula C15H10F3NOS and a molecular weight of 309.31 g/mol. Its IUPAC name is 2-benzyl-6-(trifluoromethoxy)-1,3-benzothiazole.
| Compound Name | 2-benzyl-6-(trifluoromethoxy)-1,3-benzothiazole |
|---|---|
| PubChem CID | 156595781 |
| Molecular Formula | C15H10F3NOS |
| Molecular Weight | 309.31 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 2-benzyl-6-(trifluoromethoxy)-1,3-benzothiazole |
| SMILES | FC(F)(F)Oc1ccc2nc(Cc3ccccc3)sc2c1 |
| InChI | InChI=1S/C15H10F3NOS/c16-15(17,18)20-11-6-7-12-13(9-11)21-14(19-12)8-10-4-2-1-3-5-10/h1-7,9H,8H2 |
| InChIKey | NYQOTWXOLPEFPC-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.31 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |