C15H9F3N2O3S — CID 57469780
[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl] N-phenylcarbamate (PubChem CID 57469780) has the molecular formula C15H9F3N2O3S and a molecular weight of 354.31 g/mol. Its IUPAC name is [6-(trifluoromethoxy)-1,3-benzothiazol-2-yl] N-phenylcarbamate.
| Compound Name | [6-(trifluoromethoxy)-1,3-benzothiazol-2-yl] N-phenylcarbamate |
|---|---|
| PubChem CID | 57469780 |
| Molecular Formula | C15H9F3N2O3S |
| Molecular Weight | 354.31 g/mol |
| Exact Mass | 354.03 |
| IUPAC Name | [6-(trifluoromethoxy)-1,3-benzothiazol-2-yl] N-phenylcarbamate |
| SMILES | O=C(Nc1ccccc1)Oc1nc2ccc(OC(F)(F)F)cc2s1 |
| InChI | InChI=1S/C15H9F3N2O3S/c16-15(17,18)23-10-6-7-11-12(8-10)24-14(20-11)22-13(21)19-9-4-2-1-3-5-9/h1-8H,(H,19,21) |
| InChIKey | NGZJWDFEGCPHBI-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.31 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |