C15H9F4N3OS2 — CID 44818647
1-(4-fluorophenyl)-3-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]thiourea (PubChem CID 44818647) has the molecular formula C15H9F4N3OS2 and a molecular weight of 387.38 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]thiourea.
| Compound Name | 1-(4-fluorophenyl)-3-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]thiourea |
|---|---|
| PubChem CID | 44818647 |
| Molecular Formula | C15H9F4N3OS2 |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.01 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]thiourea |
| SMILES | Fc1ccc(NC(=S)Nc2nc3ccc(OC(F)(F)F)cc3s2)cc1 |
| InChI | InChI=1S/C15H9F4N3OS2/c16-8-1-3-9(4-2-8)20-13(24)22-14-21-11-6-5-10(7-12(11)25-14)23-15(17,18)19/h1-7H,(H2,20,21,22,24) |
| InChIKey | GMFQNJDODNMJRQ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 46.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|