C15H9ClF3N3O3S — CID 127053135
1-(3-chloro-4-hydroxyphenyl)-3-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]urea (PubChem CID 127053135) has the molecular formula C15H9ClF3N3O3S and a molecular weight of 403.77 g/mol. Its IUPAC name is 1-(3-chloro-4-hydroxyphenyl)-3-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]urea.
| Compound Name | 1-(3-chloro-4-hydroxyphenyl)-3-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]urea |
|---|---|
| PubChem CID | 127053135 |
| Molecular Formula | C15H9ClF3N3O3S |
| Molecular Weight | 403.77 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | 1-(3-chloro-4-hydroxyphenyl)-3-[6-(trifluoromethoxy)-1,3-benzothiazol-2-yl]urea |
| SMILES | O=C(Nc1ccc(O)c(Cl)c1)Nc1nc2ccc(OC(F)(F)F)cc2s1 |
| InChI | InChI=1S/C15H9ClF3N3O3S/c16-9-5-7(1-4-11(9)23)20-13(24)22-14-21-10-3-2-8(6-12(10)26-14)25-15(17,18)19/h1-6,23H,(H2,20,21,22,24) |
| InChIKey | INVIWZBFJSKZLF-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 83.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.77 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|