C15H12ClN3O2S — CID 142733972
N-[2-(3-chloro-4-hydroxyanilino)-1,3-benzothiazol-6-yl]acetamide (PubChem CID 142733972) has the molecular formula C15H12ClN3O2S and a molecular weight of 333.80 g/mol. Its IUPAC name is N-[2-(3-chloro-4-hydroxyanilino)-1,3-benzothiazol-6-yl]acetamide.
| Compound Name | N-[2-(3-chloro-4-hydroxyanilino)-1,3-benzothiazol-6-yl]acetamide |
|---|---|
| PubChem CID | 142733972 |
| Molecular Formula | C15H12ClN3O2S |
| Molecular Weight | 333.80 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | N-[2-(3-chloro-4-hydroxyanilino)-1,3-benzothiazol-6-yl]acetamide |
| SMILES | CC(=O)Nc1ccc2nc(Nc3ccc(O)c(Cl)c3)sc2c1 |
| InChI | InChI=1S/C15H12ClN3O2S/c1-8(20)17-10-2-4-12-14(7-10)22-15(19-12)18-9-3-5-13(21)11(16)6-9/h2-7,21H,1H3,(H,17,20)(H,18,19) |
| InChIKey | UIEYZRXEDJUXOD-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 74.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.80 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|