C17H15ClN4O3S — CID 151022798
2-[(3-chloro-4-hydroxyphenyl)carbamoylamino]-N,N-dimethyl-1,3-benzothiazole-6-carboxamide (PubChem CID 151022798) has the molecular formula C17H15ClN4O3S and a molecular weight of 390.85 g/mol. Its IUPAC name is 2-[(3-chloro-4-hydroxyphenyl)carbamoylamino]-N,N-dimethyl-1,3-benzothiazole-6-carboxamide.
| Compound Name | 2-[(3-chloro-4-hydroxyphenyl)carbamoylamino]-N,N-dimethyl-1,3-benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 151022798 |
| Molecular Formula | C17H15ClN4O3S |
| Molecular Weight | 390.85 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 2-[(3-chloro-4-hydroxyphenyl)carbamoylamino]-N,N-dimethyl-1,3-benzothiazole-6-carboxamide |
| SMILES | CN(C)C(=O)c1ccc2nc(NC(=O)Nc3ccc(O)c(Cl)c3)sc2c1 |
| InChI | InChI=1S/C17H15ClN4O3S/c1-22(2)15(24)9-3-5-12-14(7-9)26-17(20-12)21-16(25)19-10-4-6-13(23)11(18)8-10/h3-8,23H,1-2H3,(H2,19,20,21,25) |
| InChIKey | LYKXAPUNMUMPBA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.85 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|