C15H8Cl2N4OS — CID 146254972
1-(6-chloro-1,3-benzothiazol-2-yl)-3-(3-chloro-4-cyanophenyl)urea (PubChem CID 146254972) has the molecular formula C15H8Cl2N4OS and a molecular weight of 363.23 g/mol. Its IUPAC name is 1-(6-chloro-1,3-benzothiazol-2-yl)-3-(3-chloro-4-cyanophenyl)urea.
| Compound Name | 1-(6-chloro-1,3-benzothiazol-2-yl)-3-(3-chloro-4-cyanophenyl)urea |
|---|---|
| PubChem CID | 146254972 |
| Molecular Formula | C15H8Cl2N4OS |
| Molecular Weight | 363.23 g/mol |
| Exact Mass | 361.98 |
| IUPAC Name | 1-(6-chloro-1,3-benzothiazol-2-yl)-3-(3-chloro-4-cyanophenyl)urea |
| SMILES | N#Cc1ccc(NC(=O)Nc2nc3ccc(Cl)cc3s2)cc1Cl |
| InChI | InChI=1S/C15H8Cl2N4OS/c16-9-2-4-12-13(5-9)23-15(20-12)21-14(22)19-10-3-1-8(7-18)11(17)6-10/h1-6H,(H2,19,20,21,22) |
| InChIKey | MKTOOMOBNAUMCK-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.23 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |