C14H11ClN4OS — CID 29051364
1-(3-aminophenyl)-3-(6-chloro-1,3-benzothiazol-2-yl)urea (PubChem CID 29051364) has the molecular formula C14H11ClN4OS and a molecular weight of 318.79 g/mol. Its IUPAC name is 1-(3-aminophenyl)-3-(6-chloro-1,3-benzothiazol-2-yl)urea.
| Compound Name | 1-(3-aminophenyl)-3-(6-chloro-1,3-benzothiazol-2-yl)urea |
|---|---|
| PubChem CID | 29051364 |
| Molecular Formula | C14H11ClN4OS |
| Molecular Weight | 318.79 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 1-(3-aminophenyl)-3-(6-chloro-1,3-benzothiazol-2-yl)urea |
| SMILES | Nc1cccc(NC(=O)Nc2nc3ccc(Cl)cc3s2)c1 |
| InChI | InChI=1S/C14H11ClN4OS/c15-8-4-5-11-12(6-8)21-14(18-11)19-13(20)17-10-3-1-2-9(16)7-10/h1-7H,16H2,(H2,17,18,19,20) |
| InChIKey | SEIUKIUAVUIQSH-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.79 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|