C14H7Cl2N5OS — CID 146255153
1-(4-chloro-3-cyanophenyl)-3-(5-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)urea (PubChem CID 146255153) has the molecular formula C14H7Cl2N5OS and a molecular weight of 364.22 g/mol. Its IUPAC name is 1-(4-chloro-3-cyanophenyl)-3-(5-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)urea.
| Compound Name | 1-(4-chloro-3-cyanophenyl)-3-(5-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)urea |
|---|---|
| PubChem CID | 146255153 |
| Molecular Formula | C14H7Cl2N5OS |
| Molecular Weight | 364.22 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | 1-(4-chloro-3-cyanophenyl)-3-(5-chloro-[1,3]thiazolo[5,4-b]pyridin-2-yl)urea |
| SMILES | N#Cc1cc(NC(=O)Nc2nc3ccc(Cl)nc3s2)ccc1Cl |
| InChI | InChI=1S/C14H7Cl2N5OS/c15-9-2-1-8(5-7(9)6-17)18-13(22)21-14-19-10-3-4-11(16)20-12(10)23-14/h1-5H,(H2,18,19,21,22) |
| InChIKey | CNPJMQWRMXJKDB-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.22 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|