C10H10ClN3O — CID 43703829
2-amino-N-(4-chloro-3-cyanophenyl)propanamide (PubChem CID 43703829) has the molecular formula C10H10ClN3O and a molecular weight of 223.66 g/mol. Its IUPAC name is 2-amino-N-(4-chloro-3-cyanophenyl)propanamide.
| Compound Name | 2-amino-N-(4-chloro-3-cyanophenyl)propanamide |
|---|---|
| PubChem CID | 43703829 |
| Molecular Formula | C10H10ClN3O |
| Molecular Weight | 223.66 g/mol |
| Exact Mass | 223.05 |
| IUPAC Name | 2-amino-N-(4-chloro-3-cyanophenyl)propanamide |
| SMILES | CC(N)C(=O)Nc1ccc(Cl)c(C#N)c1 |
| InChI | InChI=1S/C10H10ClN3O/c1-6(13)10(15)14-8-2-3-9(11)7(4-8)5-12/h2-4,6H,13H2,1H3,(H,14,15) |
| InChIKey | YFEKYPGAWTYSOG-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.66 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |