C12H14ClN3OS — CID 61179812
(2S)-2-amino-N-(4-chloro-3-cyanophenyl)-4-methylsulfanylbutanamide (PubChem CID 61179812) has the molecular formula C12H14ClN3OS and a molecular weight of 283.78 g/mol. Its IUPAC name is (2S)-2-amino-N-(4-chloro-3-cyanophenyl)-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-(4-chloro-3-cyanophenyl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 61179812 |
| Molecular Formula | C12H14ClN3OS |
| Molecular Weight | 283.78 g/mol |
| Exact Mass | 283.05 |
| IUPAC Name | (2S)-2-amino-N-(4-chloro-3-cyanophenyl)-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](N)C(=O)Nc1ccc(Cl)c(C#N)c1 |
| InChI | InChI=1S/C12H14ClN3OS/c1-18-5-4-11(15)12(17)16-9-2-3-10(13)8(6-9)7-14/h2-3,6,11H,4-5,15H2,1H3,(H,16,17)/t11-/m0/s1 |
| InChIKey | HYWORPJFQSXUQS-NSHDSACASA-N |
| XLogP | 2.23 |
| TPSA | 78.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.78 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |