C11H15Cl2FN2OS — CID 119263179
(2S)-2-amino-N-(3-chloro-4-fluorophenyl)-4-methylsulfanylbutanamide;hydrochloride (PubChem CID 119263179) has the molecular formula C11H15Cl2FN2OS and a molecular weight of 313.23 g/mol. Its IUPAC name is (2S)-2-amino-N-(3-chloro-4-fluorophenyl)-4-methylsulfanylbutanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N-(3-chloro-4-fluorophenyl)-4-methylsulfanylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119263179 |
| Molecular Formula | C11H15Cl2FN2OS |
| Molecular Weight | 313.23 g/mol |
| Exact Mass | 312.03 |
| IUPAC Name | (2S)-2-amino-N-(3-chloro-4-fluorophenyl)-4-methylsulfanylbutanamide;hydrochloride |
| SMILES | CSCC[C@H](N)C(=O)Nc1ccc(F)c(Cl)c1.Cl |
| InChI | InChI=1S/C11H14ClFN2OS.ClH/c1-17-5-4-10(14)11(16)15-7-2-3-9(13)8(12)6-7;/h2-3,6,10H,4-5,14H2,1H3,(H,15,16);1H/t10-;/m0./s1 |
| InChIKey | ATKVJBJRDGNGPX-PPHPATTJSA-N |
| XLogP | 2.92 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.23 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |