C19H24ClN3OS — CID 119300289
(2S)-2-amino-N-[3-chloro-4-(1-phenylethylamino)phenyl]-4-methylsulfanylbutanamide (PubChem CID 119300289) has the molecular formula C19H24ClN3OS and a molecular weight of 377.94 g/mol. Its IUPAC name is (2S)-2-amino-N-[3-chloro-4-(1-phenylethylamino)phenyl]-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-amino-N-[3-chloro-4-(1-phenylethylamino)phenyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 119300289 |
| Molecular Formula | C19H24ClN3OS |
| Molecular Weight | 377.94 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | (2S)-2-amino-N-[3-chloro-4-(1-phenylethylamino)phenyl]-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](N)C(=O)Nc1ccc(NC(C)c2ccccc2)c(Cl)c1 |
| InChI | InChI=1S/C19H24ClN3OS/c1-13(14-6-4-3-5-7-14)22-18-9-8-15(12-16(18)20)23-19(24)17(21)10-11-25-2/h3-9,12-13,17,22H,10-11,21H2,1-2H3,(H,23,24)/t13?,17-/m0/s1 |
| InChIKey | TZPYUBHHOVSRJP-RUINGEJQSA-N |
| XLogP | 4.53 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.94 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |