C20H26N4O2S — CID 119288564
(2S)-2-amino-4-methylsulfanyl-N-[1-[4-(phenylcarbamoylamino)phenyl]ethyl]butanamide (PubChem CID 119288564) has the molecular formula C20H26N4O2S and a molecular weight of 386.52 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanyl-N-[1-[4-(phenylcarbamoylamino)phenyl]ethyl]butanamide.
| Compound Name | (2S)-2-amino-4-methylsulfanyl-N-[1-[4-(phenylcarbamoylamino)phenyl]ethyl]butanamide |
|---|---|
| PubChem CID | 119288564 |
| Molecular Formula | C20H26N4O2S |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.18 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanyl-N-[1-[4-(phenylcarbamoylamino)phenyl]ethyl]butanamide |
| SMILES | CSCC[C@H](N)C(=O)NC(C)c1ccc(NC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C20H26N4O2S/c1-14(22-19(25)18(21)12-13-27-2)15-8-10-17(11-9-15)24-20(26)23-16-6-4-3-5-7-16/h3-11,14,18H,12-13,21H2,1-2H3,(H,22,25)(H2,23,24,26)/t14?,18-/m0/s1 |
| InChIKey | SPDUQWDLRMJAMO-IBYPIGCZSA-N |
| XLogP | 3.59 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |