C22H29N3O2S — CID 55963010
2-butylsulfanyl-N-[1-[4-(phenylcarbamoylamino)phenyl]ethyl]propanamide (PubChem CID 55963010) has the molecular formula C22H29N3O2S and a molecular weight of 399.56 g/mol. Its IUPAC name is 2-butylsulfanyl-N-[1-[4-(phenylcarbamoylamino)phenyl]ethyl]propanamide.
| Compound Name | 2-butylsulfanyl-N-[1-[4-(phenylcarbamoylamino)phenyl]ethyl]propanamide |
|---|---|
| PubChem CID | 55963010 |
| Molecular Formula | C22H29N3O2S |
| Molecular Weight | 399.56 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 2-butylsulfanyl-N-[1-[4-(phenylcarbamoylamino)phenyl]ethyl]propanamide |
| SMILES | CCCCSC(C)C(=O)NC(C)c1ccc(NC(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C22H29N3O2S/c1-4-5-15-28-17(3)21(26)23-16(2)18-11-13-20(14-12-18)25-22(27)24-19-9-7-6-8-10-19/h6-14,16-17H,4-5,15H2,1-3H3,(H,23,26)(H2,24,25,27) |
| InChIKey | MBNKLRDXCYQSHS-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.56 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|