C15H24N2O3S2 — CID 134037901
2-butylsulfanyl-N-[1-(4-sulfamoylphenyl)ethyl]propanamide (PubChem CID 134037901) has the molecular formula C15H24N2O3S2 and a molecular weight of 344.50 g/mol. Its IUPAC name is 2-butylsulfanyl-N-[1-(4-sulfamoylphenyl)ethyl]propanamide.
| Compound Name | 2-butylsulfanyl-N-[1-(4-sulfamoylphenyl)ethyl]propanamide |
|---|---|
| PubChem CID | 134037901 |
| Molecular Formula | C15H24N2O3S2 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 2-butylsulfanyl-N-[1-(4-sulfamoylphenyl)ethyl]propanamide |
| SMILES | CCCCSC(C)C(=O)NC(C)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H24N2O3S2/c1-4-5-10-21-12(3)15(18)17-11(2)13-6-8-14(9-7-13)22(16,19)20/h6-9,11-12H,4-5,10H2,1-3H3,(H,17,18)(H2,16,19,20) |
| InChIKey | TVWCZDNJCNTLJY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|