C14H23N3O3S — CID 104683857
5-amino-2-methyl-N-[1-(4-sulfamoylphenyl)ethyl]pentanamide (PubChem CID 104683857) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is 5-amino-2-methyl-N-[1-(4-sulfamoylphenyl)ethyl]pentanamide.
| Compound Name | 5-amino-2-methyl-N-[1-(4-sulfamoylphenyl)ethyl]pentanamide |
|---|---|
| PubChem CID | 104683857 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 5-amino-2-methyl-N-[1-(4-sulfamoylphenyl)ethyl]pentanamide |
| SMILES | CC(CCCN)C(=O)NC(C)c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C14H23N3O3S/c1-10(4-3-9-15)14(18)17-11(2)12-5-7-13(8-6-12)21(16,19)20/h5-8,10-11H,3-4,9,15H2,1-2H3,(H,17,18)(H2,16,19,20) |
| InChIKey | OBQJGPYYJBYRRN-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 115.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |