C14H20ClN3O2S — CID 104907146
(2R)-2-amino-N-[2-chloro-5-(propanoylamino)phenyl]-4-methylsulfanylbutanamide (PubChem CID 104907146) has the molecular formula C14H20ClN3O2S and a molecular weight of 329.85 g/mol. Its IUPAC name is (2R)-2-amino-N-[2-chloro-5-(propanoylamino)phenyl]-4-methylsulfanylbutanamide.
| Compound Name | (2R)-2-amino-N-[2-chloro-5-(propanoylamino)phenyl]-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 104907146 |
| Molecular Formula | C14H20ClN3O2S |
| Molecular Weight | 329.85 g/mol |
| Exact Mass | 329.10 |
| IUPAC Name | (2R)-2-amino-N-[2-chloro-5-(propanoylamino)phenyl]-4-methylsulfanylbutanamide |
| SMILES | CCC(=O)Nc1ccc(Cl)c(NC(=O)[C@H](N)CCSC)c1 |
| InChI | InChI=1S/C14H20ClN3O2S/c1-3-13(19)17-9-4-5-10(15)12(8-9)18-14(20)11(16)6-7-21-2/h4-5,8,11H,3,6-7,16H2,1-2H3,(H,17,19)(H,18,20)/t11-/m1/s1 |
| InChIKey | WPQQFWZNNCVBCA-LLVKDONJSA-N |
| XLogP | 2.71 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.85 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |