C12H16ClN3O2S — CID 61179378
4-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-2-chlorobenzamide (PubChem CID 61179378) has the molecular formula C12H16ClN3O2S and a molecular weight of 301.80 g/mol. Its IUPAC name is 4-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-2-chlorobenzamide.
| Compound Name | 4-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-2-chlorobenzamide |
|---|---|
| PubChem CID | 61179378 |
| Molecular Formula | C12H16ClN3O2S |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | 4-[[(2S)-2-amino-4-methylsulfanylbutanoyl]amino]-2-chlorobenzamide |
| SMILES | CSCC[C@H](N)C(=O)Nc1ccc(C(N)=O)c(Cl)c1 |
| InChI | InChI=1S/C12H16ClN3O2S/c1-19-5-4-10(14)12(18)16-7-2-3-8(11(15)17)9(13)6-7/h2-3,6,10H,4-5,14H2,1H3,(H2,15,17)(H,16,18)/t10-/m0/s1 |
| InChIKey | LWVYFWIADOLPEM-JTQLQIEISA-N |
| XLogP | 1.46 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |