C20H22ClN3O3S — CID 55641796
2-chloro-4-[[2-[(3-methylbenzoyl)amino]-4-methylsulfanylbutanoyl]amino]benzamide (PubChem CID 55641796) has the molecular formula C20H22ClN3O3S and a molecular weight of 419.93 g/mol. Its IUPAC name is 2-chloro-4-[[2-[(3-methylbenzoyl)amino]-4-methylsulfanylbutanoyl]amino]benzamide.
| Compound Name | 2-chloro-4-[[2-[(3-methylbenzoyl)amino]-4-methylsulfanylbutanoyl]amino]benzamide |
|---|---|
| PubChem CID | 55641796 |
| Molecular Formula | C20H22ClN3O3S |
| Molecular Weight | 419.93 g/mol |
| Exact Mass | 419.11 |
| IUPAC Name | 2-chloro-4-[[2-[(3-methylbenzoyl)amino]-4-methylsulfanylbutanoyl]amino]benzamide |
| SMILES | CSCCC(NC(=O)c1cccc(C)c1)C(=O)Nc1ccc(C(N)=O)c(Cl)c1 |
| InChI | InChI=1S/C20H22ClN3O3S/c1-12-4-3-5-13(10-12)19(26)24-17(8-9-28-2)20(27)23-14-6-7-15(18(22)25)16(21)11-14/h3-7,10-11,17H,8-9H2,1-2H3,(H2,22,25)(H,23,27)(H,24,26) |
| InChIKey | AGYROZIEGXTXIK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.93 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |