C20H22N4O2S — CID 97072071
N-[(2R)-1-(1H-indazol-5-ylamino)-4-methylsulfanyl-1-oxobutan-2-yl]-3-methylbenzamide (PubChem CID 97072071) has the molecular formula C20H22N4O2S and a molecular weight of 382.49 g/mol. Its IUPAC name is N-[(2R)-1-(1H-indazol-5-ylamino)-4-methylsulfanyl-1-oxobutan-2-yl]-3-methylbenzamide.
| Compound Name | N-[(2R)-1-(1H-indazol-5-ylamino)-4-methylsulfanyl-1-oxobutan-2-yl]-3-methylbenzamide |
|---|---|
| PubChem CID | 97072071 |
| Molecular Formula | C20H22N4O2S |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N-[(2R)-1-(1H-indazol-5-ylamino)-4-methylsulfanyl-1-oxobutan-2-yl]-3-methylbenzamide |
| SMILES | CSCC[C@@H](NC(=O)c1cccc(C)c1)C(=O)Nc1ccc2[nH]ncc2c1 |
| InChI | InChI=1S/C20H22N4O2S/c1-13-4-3-5-14(10-13)19(25)23-18(8-9-27-2)20(26)22-16-6-7-17-15(11-16)12-21-24-17/h3-7,10-12,18H,8-9H2,1-2H3,(H,21,24)(H,22,26)(H,23,25)/t18-/m1/s1 |
| InChIKey | KYLUHSAKJKGSEI-GOSISDBHSA-N |
| XLogP | 3.36 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |