C23H24N2O2S — CID 51065900
4-methyl-N-[4-methylsulfanyl-1-(naphthalen-2-ylamino)-1-oxobutan-2-yl]benzamide (PubChem CID 51065900) has the molecular formula C23H24N2O2S and a molecular weight of 392.52 g/mol. Its IUPAC name is 4-methyl-N-[4-methylsulfanyl-1-(naphthalen-2-ylamino)-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-methyl-N-[4-methylsulfanyl-1-(naphthalen-2-ylamino)-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 51065900 |
| Molecular Formula | C23H24N2O2S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.16 |
| IUPAC Name | 4-methyl-N-[4-methylsulfanyl-1-(naphthalen-2-ylamino)-1-oxobutan-2-yl]benzamide |
| SMILES | CSCCC(NC(=O)c1ccc(C)cc1)C(=O)Nc1ccc2ccccc2c1 |
| InChI | InChI=1S/C23H24N2O2S/c1-16-7-9-18(10-8-16)22(26)25-21(13-14-28-2)23(27)24-20-12-11-17-5-3-4-6-19(17)15-20/h3-12,15,21H,13-14H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | DCWYIAKAHUQBSR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |