C11H14ClF2IN2OS — CID 119312520
(2S)-2-amino-N-(3,5-difluoro-4-iodophenyl)-4-methylsulfanylbutanamide;hydrochloride (PubChem CID 119312520) has the molecular formula C11H14ClF2IN2OS and a molecular weight of 422.67 g/mol. Its IUPAC name is (2S)-2-amino-N-(3,5-difluoro-4-iodophenyl)-4-methylsulfanylbutanamide;hydrochloride.
| Compound Name | (2S)-2-amino-N-(3,5-difluoro-4-iodophenyl)-4-methylsulfanylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119312520 |
| Molecular Formula | C11H14ClF2IN2OS |
| Molecular Weight | 422.67 g/mol |
| Exact Mass | 421.95 |
| IUPAC Name | (2S)-2-amino-N-(3,5-difluoro-4-iodophenyl)-4-methylsulfanylbutanamide;hydrochloride |
| SMILES | CSCC[C@H](N)C(=O)Nc1cc(F)c(I)c(F)c1.Cl |
| InChI | InChI=1S/C11H13F2IN2OS.ClH/c1-18-3-2-9(15)11(17)16-6-4-7(12)10(14)8(13)5-6;/h4-5,9H,2-3,15H2,1H3,(H,16,17);1H/t9-;/m0./s1 |
| InChIKey | PASDURMMFAXLFY-FVGYRXGTSA-N |
| XLogP | 3.01 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.67 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|