C11H13F2IN2O — CID 120500001
3-amino-N-(3,5-difluoro-4-iodophenyl)-2-methylbutanamide (PubChem CID 120500001) has the molecular formula C11H13F2IN2O and a molecular weight of 354.14 g/mol. Its IUPAC name is 3-amino-N-(3,5-difluoro-4-iodophenyl)-2-methylbutanamide.
| Compound Name | 3-amino-N-(3,5-difluoro-4-iodophenyl)-2-methylbutanamide |
|---|---|
| PubChem CID | 120500001 |
| Molecular Formula | C11H13F2IN2O |
| Molecular Weight | 354.14 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | 3-amino-N-(3,5-difluoro-4-iodophenyl)-2-methylbutanamide |
| SMILES | CC(N)C(C)C(=O)Nc1cc(F)c(I)c(F)c1 |
| InChI | InChI=1S/C11H13F2IN2O/c1-5(6(2)15)11(17)16-7-3-8(12)10(14)9(13)4-7/h3-6H,15H2,1-2H3,(H,16,17) |
| InChIKey | IBXQTFTXBJXLLK-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.14 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|