C16H23FN2O2 — CID 120501730
3-amino-N-(4-cyclopentyloxy-3-fluorophenyl)-2-methylbutanamide (PubChem CID 120501730) has the molecular formula C16H23FN2O2 and a molecular weight of 294.37 g/mol. Its IUPAC name is 3-amino-N-(4-cyclopentyloxy-3-fluorophenyl)-2-methylbutanamide.
| Compound Name | 3-amino-N-(4-cyclopentyloxy-3-fluorophenyl)-2-methylbutanamide |
|---|---|
| PubChem CID | 120501730 |
| Molecular Formula | C16H23FN2O2 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.17 |
| IUPAC Name | 3-amino-N-(4-cyclopentyloxy-3-fluorophenyl)-2-methylbutanamide |
| SMILES | CC(N)C(C)C(=O)Nc1ccc(OC2CCCC2)c(F)c1 |
| InChI | InChI=1S/C16H23FN2O2/c1-10(11(2)18)16(20)19-12-7-8-15(14(17)9-12)21-13-5-3-4-6-13/h7-11,13H,3-6,18H2,1-2H3,(H,19,20) |
| InChIKey | HOAXXIUYBYMKRP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |