C18H27FN2O2 — CID 119806500
7-amino-N-(4-cyclopentyloxy-3-fluorophenyl)heptanamide (PubChem CID 119806500) has the molecular formula C18H27FN2O2 and a molecular weight of 322.42 g/mol. Its IUPAC name is 7-amino-N-(4-cyclopentyloxy-3-fluorophenyl)heptanamide.
| Compound Name | 7-amino-N-(4-cyclopentyloxy-3-fluorophenyl)heptanamide |
|---|---|
| PubChem CID | 119806500 |
| Molecular Formula | C18H27FN2O2 |
| Molecular Weight | 322.42 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 7-amino-N-(4-cyclopentyloxy-3-fluorophenyl)heptanamide |
| SMILES | NCCCCCCC(=O)Nc1ccc(OC2CCCC2)c(F)c1 |
| InChI | InChI=1S/C18H27FN2O2/c19-16-13-14(21-18(22)9-3-1-2-6-12-20)10-11-17(16)23-15-7-4-5-8-15/h10-11,13,15H,1-9,12,20H2,(H,21,22) |
| InChIKey | ZAIGSIAZCIZQIE-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|