C12H15ClFN3O2S — CID 2078416
(2S)-2-(carbamoylamino)-N-(3-chloro-4-fluorophenyl)-4-methylsulfanylbutanamide (PubChem CID 2078416) has the molecular formula C12H15ClFN3O2S and a molecular weight of 319.79 g/mol. Its IUPAC name is (2S)-2-(carbamoylamino)-N-(3-chloro-4-fluorophenyl)-4-methylsulfanylbutanamide.
| Compound Name | (2S)-2-(carbamoylamino)-N-(3-chloro-4-fluorophenyl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 2078416 |
| Molecular Formula | C12H15ClFN3O2S |
| Molecular Weight | 319.79 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | (2S)-2-(carbamoylamino)-N-(3-chloro-4-fluorophenyl)-4-methylsulfanylbutanamide |
| SMILES | CSCC[C@H](NC(N)=O)C(=O)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C12H15ClFN3O2S/c1-20-5-4-10(17-12(15)19)11(18)16-7-2-3-9(14)8(13)6-7/h2-3,6,10H,4-5H2,1H3,(H,16,18)(H3,15,17,19)/t10-/m0/s1 |
| InChIKey | LACGSTSCHBQDGW-JTQLQIEISA-N |
| XLogP | 2.21 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.79 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |