C13H18ClN3O3S — CID 2098066
(2R)-2-(carbamoylamino)-N-(3-chloro-4-methoxyphenyl)-4-methylsulfanylbutanamide (PubChem CID 2098066) has the molecular formula C13H18ClN3O3S and a molecular weight of 331.83 g/mol. Its IUPAC name is (2R)-2-(carbamoylamino)-N-(3-chloro-4-methoxyphenyl)-4-methylsulfanylbutanamide.
| Compound Name | (2R)-2-(carbamoylamino)-N-(3-chloro-4-methoxyphenyl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 2098066 |
| Molecular Formula | C13H18ClN3O3S |
| Molecular Weight | 331.83 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | (2R)-2-(carbamoylamino)-N-(3-chloro-4-methoxyphenyl)-4-methylsulfanylbutanamide |
| SMILES | COc1ccc(NC(=O)[C@@H](CCSC)NC(N)=O)cc1Cl |
| InChI | InChI=1S/C13H18ClN3O3S/c1-20-11-4-3-8(7-9(11)14)16-12(18)10(5-6-21-2)17-13(15)19/h3-4,7,10H,5-6H2,1-2H3,(H,16,18)(H3,15,17,19)/t10-/m1/s1 |
| InChIKey | OQJWHXHDIDANTP-SNVBAGLBSA-N |
| XLogP | 2.08 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.83 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |