C13H18FN3O2S — CID 47097093
2-(carbamoylamino)-N-(2-fluoro-5-methylphenyl)-4-methylsulfanylbutanamide (PubChem CID 47097093) has the molecular formula C13H18FN3O2S and a molecular weight of 299.37 g/mol. Its IUPAC name is 2-(carbamoylamino)-N-(2-fluoro-5-methylphenyl)-4-methylsulfanylbutanamide.
| Compound Name | 2-(carbamoylamino)-N-(2-fluoro-5-methylphenyl)-4-methylsulfanylbutanamide |
|---|---|
| PubChem CID | 47097093 |
| Molecular Formula | C13H18FN3O2S |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | 2-(carbamoylamino)-N-(2-fluoro-5-methylphenyl)-4-methylsulfanylbutanamide |
| SMILES | CSCCC(NC(N)=O)C(=O)Nc1cc(C)ccc1F |
| InChI | InChI=1S/C13H18FN3O2S/c1-8-3-4-9(14)11(7-8)16-12(18)10(5-6-20-2)17-13(15)19/h3-4,7,10H,5-6H2,1-2H3,(H,16,18)(H3,15,17,19) |
| InChIKey | TZMYENNULXYZFU-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |