C12H9Cl2N5O — CID 104593247
1-(4-cyano-1-methylpyrazol-3-yl)-3-(3,4-dichlorophenyl)urea (PubChem CID 104593247) has the molecular formula C12H9Cl2N5O and a molecular weight of 310.14 g/mol. Its IUPAC name is 1-(4-cyano-1-methylpyrazol-3-yl)-3-(3,4-dichlorophenyl)urea.
| Compound Name | 1-(4-cyano-1-methylpyrazol-3-yl)-3-(3,4-dichlorophenyl)urea |
|---|---|
| PubChem CID | 104593247 |
| Molecular Formula | C12H9Cl2N5O |
| Molecular Weight | 310.14 g/mol |
| Exact Mass | 309.02 |
| IUPAC Name | 1-(4-cyano-1-methylpyrazol-3-yl)-3-(3,4-dichlorophenyl)urea |
| SMILES | Cn1cc(C#N)c(NC(=O)Nc2ccc(Cl)c(Cl)c2)n1 |
| InChI | InChI=1S/C12H9Cl2N5O/c1-19-6-7(5-15)11(18-19)17-12(20)16-8-2-3-9(13)10(14)4-8/h2-4,6H,1H3,(H2,16,17,18,20) |
| InChIKey | DXHZTKUBRINUEB-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 82.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.14 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |